C13H19NO — CID 142928998
N-[1-(4-methoxy-3-methylphenyl)ethenyl]propan-1-amine (PubChem CID 142928998) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is N-[1-(4-methoxy-3-methylphenyl)ethenyl]propan-1-amine.
| Compound Name | N-[1-(4-methoxy-3-methylphenyl)ethenyl]propan-1-amine |
|---|---|
| PubChem CID | 142928998 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | N-[1-(4-methoxy-3-methylphenyl)ethenyl]propan-1-amine |
| SMILES | C=C(NCCC)c1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C13H19NO/c1-5-8-14-11(3)12-6-7-13(15-4)10(2)9-12/h6-7,9,14H,3,5,8H2,1-2,4H3 |
| InChIKey | WSKGVBSUWTWUHS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |