C25H31N3OS — CID 142931440
N-[4-[2-(dimethylamino)ethylamino]phenyl]-4-phenylsulfanylbenzamide;ethane (PubChem CID 142931440) has the molecular formula C25H31N3OS and a molecular weight of 421.61 g/mol. Its IUPAC name is N-[4-[2-(dimethylamino)ethylamino]phenyl]-4-phenylsulfanylbenzamide;ethane.
| Compound Name | N-[4-[2-(dimethylamino)ethylamino]phenyl]-4-phenylsulfanylbenzamide;ethane |
|---|---|
| PubChem CID | 142931440 |
| Molecular Formula | C25H31N3OS |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | N-[4-[2-(dimethylamino)ethylamino]phenyl]-4-phenylsulfanylbenzamide;ethane |
| SMILES | CC.CN(C)CCNc1ccc(NC(=O)c2ccc(Sc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H25N3OS.C2H6/c1-26(2)17-16-24-19-10-12-20(13-11-19)25-23(27)18-8-14-22(15-9-18)28-21-6-4-3-5-7-21;1-2/h3-15,24H,16-17H2,1-2H3,(H,25,27);1-2H3 |
| InChIKey | RQWULFGTUNJGQY-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |