C8H20N2O2 — CID 14293145
(2S,3S)-2,3-diethoxybutane-1,4-diamine (PubChem CID 14293145) has the molecular formula C8H20N2O2 and a molecular weight of 176.26 g/mol. Its IUPAC name is (2S,3S)-2,3-diethoxybutane-1,4-diamine.
| Compound Name | (2S,3S)-2,3-diethoxybutane-1,4-diamine |
|---|---|
| PubChem CID | 14293145 |
| Molecular Formula | C8H20N2O2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.15 |
| IUPAC Name | (2S,3S)-2,3-diethoxybutane-1,4-diamine |
| SMILES | CCO[C@@H](CN)[C@H](CN)OCC |
| InChI | InChI=1S/C8H20N2O2/c1-3-11-7(5-9)8(6-10)12-4-2/h7-8H,3-6,9-10H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | XMLNGDVFPUGPTG-YUMQZZPRSA-N |
| XLogP | -1.10 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | 89 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |