C24H35N3O2 — CID 142931774
2,5-dimethylhexa-1,5-diene;methanamine;N-(4-pyrrolidin-1-ylphenyl)furan-2-carboxamide (PubChem CID 142931774) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is 2,5-dimethylhexa-1,5-diene;methanamine;N-(4-pyrrolidin-1-ylphenyl)furan-2-carboxamide.
| Compound Name | 2,5-dimethylhexa-1,5-diene;methanamine;N-(4-pyrrolidin-1-ylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 142931774 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | 2,5-dimethylhexa-1,5-diene;methanamine;N-(4-pyrrolidin-1-ylphenyl)furan-2-carboxamide |
| SMILES | C=C(C)CCC(=C)C.CN.O=C(Nc1ccc(N2CCCC2)cc1)c1ccco1 |
| InChI | InChI=1S/C15H16N2O2.C8H14.CH5N/c18-15(14-4-3-11-19-14)16-12-5-7-13(8-6-12)17-9-1-2-10-17;1-7(2)5-6-8(3)4;1-2/h3-8,11H,1-2,9-10H2,(H,16,18);1,3,5-6H2,2,4H3;2H2,1H3 |
| InChIKey | DIFKWIQRLWSEOS-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|