C21H35NS — CID 142933319
(Z,2Z,3Z)-3-(cyclopentylmethylidene)-2-ethylidene-4-methyl-N-(1-propylsulfanylethyl)pent-4-en-1-imine;ethene (PubChem CID 142933319) has the molecular formula C21H35NS and a molecular weight of 333.59 g/mol. Its IUPAC name is (Z,2Z,3Z)-3-(cyclopentylmethylidene)-2-ethylidene-4-methyl-N-(1-propylsulfanylethyl)pent-4-en-1-imine;ethene.
| Compound Name | (Z,2Z,3Z)-3-(cyclopentylmethylidene)-2-ethylidene-4-methyl-N-(1-propylsulfanylethyl)pent-4-en-1-imine;ethene |
|---|---|
| PubChem CID | 142933319 |
| Molecular Formula | C21H35NS |
| Molecular Weight | 333.59 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | (Z,2Z,3Z)-3-(cyclopentylmethylidene)-2-ethylidene-4-methyl-N-(1-propylsulfanylethyl)pent-4-en-1-imine;ethene |
| SMILES | C=C.C=C(C)C(=C/C1CCCC1)/C(/C=N\C(C)SCCC)=C/C |
| InChI | InChI=1S/C19H31NS.C2H4/c1-6-12-21-16(5)20-14-18(7-2)19(15(3)4)13-17-10-8-9-11-17;1-2/h7,13-14,16-17H,3,6,8-12H2,1-2,4-5H3;1-2H2/b18-7+,19-13-,20-14-; |
| InChIKey | AEXXKWSNXFYVKL-XQEODPFVSA-N |
| XLogP | 6.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.59 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|