C17H29NS — CID 143703437
(2E)-N-ethyl-3-(4-methylcyclohex-2-en-1-yl)sulfanylpenta-2,4-dien-1-imine;propane (PubChem CID 143703437) has the molecular formula C17H29NS and a molecular weight of 279.49 g/mol. Its IUPAC name is (2E)-N-ethyl-3-(4-methylcyclohex-2-en-1-yl)sulfanylpenta-2,4-dien-1-imine;propane.
| Compound Name | (2E)-N-ethyl-3-(4-methylcyclohex-2-en-1-yl)sulfanylpenta-2,4-dien-1-imine;propane |
|---|---|
| PubChem CID | 143703437 |
| Molecular Formula | C17H29NS |
| Molecular Weight | 279.49 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | (2E)-N-ethyl-3-(4-methylcyclohex-2-en-1-yl)sulfanylpenta-2,4-dien-1-imine;propane |
| SMILES | C=C/C(=C\C=N\CC)SC1C=CC(C)CC1.CCC |
| InChI | InChI=1S/C14H21NS.C3H8/c1-4-13(10-11-15-5-2)16-14-8-6-12(3)7-9-14;1-3-2/h4,6,8,10-12,14H,1,5,7,9H2,2-3H3;3H2,1-2H3/b13-10+,15-11+; |
| InChIKey | VRYPNOWURHTBGL-GRTWUSEASA-N |
| XLogP | 5.65 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|