C20H23NS — CID 144984591
(2Z,4E)-6-[(Z)-(2-ethylidene-4,5-dihydro-1-benzothiophen-3-ylidene)methyl]-N,5-dimethylhepta-2,4,6-trien-1-imine (PubChem CID 144984591) has the molecular formula C20H23NS and a molecular weight of 309.48 g/mol. Its IUPAC name is (2Z,4E)-6-[(Z)-(2-ethylidene-4,5-dihydro-1-benzothiophen-3-ylidene)methyl]-N,5-dimethylhepta-2,4,6-trien-1-imine.
| Compound Name | (2Z,4E)-6-[(Z)-(2-ethylidene-4,5-dihydro-1-benzothiophen-3-ylidene)methyl]-N,5-dimethylhepta-2,4,6-trien-1-imine |
|---|---|
| PubChem CID | 144984591 |
| Molecular Formula | C20H23NS |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | (2Z,4E)-6-[(Z)-(2-ethylidene-4,5-dihydro-1-benzothiophen-3-ylidene)methyl]-N,5-dimethylhepta-2,4,6-trien-1-imine |
| SMILES | C=C(/C=c1/c2c(sc1=CC)C=CCC2)/C(C)=C/C=C\C=N\C |
| InChI | InChI=1S/C20H23NS/c1-5-19-18(17-11-6-7-12-20(17)22-19)14-16(3)15(2)10-8-9-13-21-4/h5,7-10,12-14H,3,6,11H2,1-2,4H3/b9-8-,15-10+,18-14-,19-5?,21-13+ |
| InChIKey | RFDUAHUYBPUGAA-HIVPBWCSSA-N |
| XLogP | 4.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|