C12H23NO2 — CID 142933356
ethane;(Z,1Z)-1-(2-methylpiperidin-4-ylidene)but-2-ene-2,3-diol (PubChem CID 142933356) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is ethane;(Z,1Z)-1-(2-methylpiperidin-4-ylidene)but-2-ene-2,3-diol.
| Compound Name | ethane;(Z,1Z)-1-(2-methylpiperidin-4-ylidene)but-2-ene-2,3-diol |
|---|---|
| PubChem CID | 142933356 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | ethane;(Z,1Z)-1-(2-methylpiperidin-4-ylidene)but-2-ene-2,3-diol |
| SMILES | C/C(O)=C(O)\C=C1\CCNC(C)C1.CC |
| InChI | InChI=1S/C10H17NO2.C2H6/c1-7-5-9(3-4-11-7)6-10(13)8(2)12;1-2/h6-7,11-13H,3-5H2,1-2H3;1-2H3/b9-6-,10-8-; |
| InChIKey | WQGUQYHPKZKGLV-SXHUHTSVSA-N |
| XLogP | 3.06 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|