C11H19NO2 — CID 142193874
2-butyl-3-(hydroxymethylamino)cyclohexa-1,5-dien-1-ol (PubChem CID 142193874) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-butyl-3-(hydroxymethylamino)cyclohexa-1,5-dien-1-ol.
| Compound Name | 2-butyl-3-(hydroxymethylamino)cyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 142193874 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 2-butyl-3-(hydroxymethylamino)cyclohexa-1,5-dien-1-ol |
| SMILES | CCCCC1=C(O)C=CCC1NCO |
| InChI | InChI=1S/C11H19NO2/c1-2-3-5-9-10(12-8-13)6-4-7-11(9)14/h4,7,10,12-14H,2-3,5-6,8H2,1H3 |
| InChIKey | UIGIJFHJVDERQZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|