C12H19NO3 — CID 176520572
[3-hydroxy-6-(pentylamino)cyclohexa-2,4-dien-1-ylidene]methanone;hydrate (PubChem CID 176520572) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is [3-hydroxy-6-(pentylamino)cyclohexa-2,4-dien-1-ylidene]methanone;hydrate.
| Compound Name | [3-hydroxy-6-(pentylamino)cyclohexa-2,4-dien-1-ylidene]methanone;hydrate |
|---|---|
| PubChem CID | 176520572 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | [3-hydroxy-6-(pentylamino)cyclohexa-2,4-dien-1-ylidene]methanone;hydrate |
| SMILES | CCCCCNC1C=CC(O)=CC1=C=O.O |
| InChI | InChI=1S/C12H17NO2.H2O/c1-2-3-4-7-13-12-6-5-11(15)8-10(12)9-14;/h5-6,8,12-13,15H,2-4,7H2,1H3;1H2 |
| InChIKey | XONBRFLTZKABDA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 80.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|