C11H19NO — CID 143401875
(3E,5Z)-4-[(1S)-1-(methylamino)ethyl]octa-1,3,5-trien-2-ol (PubChem CID 143401875) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (3E,5Z)-4-[(1S)-1-(methylamino)ethyl]octa-1,3,5-trien-2-ol.
| Compound Name | (3E,5Z)-4-[(1S)-1-(methylamino)ethyl]octa-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 143401875 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (3E,5Z)-4-[(1S)-1-(methylamino)ethyl]octa-1,3,5-trien-2-ol |
| SMILES | C=C(O)/C=C(\C=C/CC)[C@H](C)NC |
| InChI | InChI=1S/C11H19NO/c1-5-6-7-11(8-9(2)13)10(3)12-4/h6-8,10,12-13H,2,5H2,1,3-4H3/b7-6-,11-8+/t10-/m0/s1 |
| InChIKey | FYAXOMZFWRIONT-IIFZHAGLSA-N |
| XLogP | 2.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|