C10H17NO — CID 123793937
(3-methylideneocta-4,6-dien-2-ylamino)methanol (PubChem CID 123793937) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (3-methylideneocta-4,6-dien-2-ylamino)methanol.
| Compound Name | (3-methylideneocta-4,6-dien-2-ylamino)methanol |
|---|---|
| PubChem CID | 123793937 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (3-methylideneocta-4,6-dien-2-ylamino)methanol |
| SMILES | C=C(C=CC=CC)C(C)NCO |
| InChI | InChI=1S/C10H17NO/c1-4-5-6-7-9(2)10(3)11-8-12/h4-7,10-12H,2,8H2,1,3H3 |
| InChIKey | RRCVHMDVCSTRLG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|