C10H19NO — CID 89153849
[[(5E)-6-methylocta-1,5-dien-3-yl]amino]methanol (PubChem CID 89153849) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is [[(5E)-6-methylocta-1,5-dien-3-yl]amino]methanol.
| Compound Name | [[(5E)-6-methylocta-1,5-dien-3-yl]amino]methanol |
|---|---|
| PubChem CID | 89153849 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | [[(5E)-6-methylocta-1,5-dien-3-yl]amino]methanol |
| SMILES | C=CC(C/C=C(\C)CC)NCO |
| InChI | InChI=1S/C10H19NO/c1-4-9(3)6-7-10(5-2)11-8-12/h5-6,10-12H,2,4,7-8H2,1,3H3/b9-6+ |
| InChIKey | UHRUUXYGJUCWAH-RMKNXTFCSA-N |
| XLogP | 1.83 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|