C11H19NO — CID 123548852
[[1-(4-methylhexa-1,4-dienyl)cyclopropyl]amino]methanol (PubChem CID 123548852) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is [[1-(4-methylhexa-1,4-dienyl)cyclopropyl]amino]methanol.
| Compound Name | [[1-(4-methylhexa-1,4-dienyl)cyclopropyl]amino]methanol |
|---|---|
| PubChem CID | 123548852 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | [[1-(4-methylhexa-1,4-dienyl)cyclopropyl]amino]methanol |
| SMILES | CC=C(C)CC=CC1(NCO)CC1 |
| InChI | InChI=1S/C11H19NO/c1-3-10(2)5-4-6-11(7-8-11)12-9-13/h3-4,6,12-13H,5,7-9H2,1-2H3 |
| InChIKey | OOFQZZGDGGBBAY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|