C10H19NOU — CID 142360653
(2-cyclohexa-1,5-dien-1-ylpropan-2-ylamino)methanol;molecular hydrogen;uranium (PubChem CID 142360653) has the molecular formula C10H19NOU and a molecular weight of 407.30 g/mol. Its IUPAC name is (2-cyclohexa-1,5-dien-1-ylpropan-2-ylamino)methanol;molecular hydrogen;uranium.
| Compound Name | (2-cyclohexa-1,5-dien-1-ylpropan-2-ylamino)methanol;molecular hydrogen;uranium |
|---|---|
| PubChem CID | 142360653 |
| Molecular Formula | C10H19NOU |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | (2-cyclohexa-1,5-dien-1-ylpropan-2-ylamino)methanol;molecular hydrogen;uranium |
| SMILES | CC(C)(NCO)C1=CCCC=C1.[H][H].[U] |
| InChI | InChI=1S/C10H17NO.U.H2/c1-10(2,11-8-12)9-6-4-3-5-7-9;;/h4,6-7,11-12H,3,5,8H2,1-2H3;;1H |
| InChIKey | CNVNGDABBZLZOY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|