About [[1-[(E)-6,6-dimethylhept-1-enyl]cyclopropyl]amino]methanol
[[1-[(E)-6,6-dimethylhept-1-enyl]cyclopropyl]amino]methanol (PubChem CID 142399892) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is [[1-[(E)-6,6-dimethylhept-1-enyl]cyclopropyl]amino]methanol.
Molecular Properties
| Compound Name | [[1-[(E)-6,6-dimethylhept-1-enyl]cyclopropyl]amino]methanol |
| PubChem CID | 142399892 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | [[1-[(E)-6,6-dimethylhept-1-enyl]cyclopropyl]amino]methanol |
| SMILES | CC(C)(C)CCC/C=C/C1(NCO)CC1 |
| InChI | InChI=1S/C13H25NO/c1-12(2,3)7-5-4-6-8-13(9-10-13)14-11-15/h6,8,14-15H,4-5,7,9-11H2,1-3H3/b8-6+ |
| InChIKey | NXXGTPPLTVODBE-SOFGYWHQSA-N |
| XLogP | 2.83 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [[1-[(E)-6,6-dimethylhept-1-enyl]cyclopropyl]amino]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[1-[(E)-6,6-dimethylhept-1-enyl]cyclopropyl]amino]methanol?
The IUPAC name of [[1-[(E)-6,6-dimethylhept-1-enyl]cyclopropyl]amino]methanol (CID 142399892) is [[1-[(E)-6,6-dimethylhept-1-enyl]cyclopropyl]amino]methanol.
What is the SMILES notation for [[1-[(E)-6,6-dimethylhept-1-enyl]cyclopropyl]amino]methanol?
The canonical SMILES for [[1-[(E)-6,6-dimethylhept-1-enyl]cyclopropyl]amino]methanol is CC(C)(C)CCC/C=C/C1(NCO)CC1.
What is the InChIKey of [[1-[(E)-6,6-dimethylhept-1-enyl]cyclopropyl]amino]methanol?
The InChIKey is NXXGTPPLTVODBE-SOFGYWHQSA-N. The full InChI is InChI=1S/C13H25NO/c1-12(2,3)7-5-4-6-8-13(9-10-13)14-11-15/h6,8,14-15H,4-5,7,9-11H2,1-3H3/b8-6+.
What are the key properties of [[1-[(E)-6,6-dimethylhept-1-enyl]cyclopropyl]amino]methanol?
[[1-[(E)-6,6-dimethylhept-1-enyl]cyclopropyl]amino]methanol has a molecular weight of 211.35 g/mol, XLogP of 2.83, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [[1-[(E)-6,6-dimethylhept-1-enyl]cyclopropyl]amino]methanol is sourced from PubChem (CID 142399892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).