C14H29NO — CID 142399777
[[(E)-2,8,8-trimethyldec-5-en-2-yl]amino]methanol (PubChem CID 142399777) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is [[(E)-2,8,8-trimethyldec-5-en-2-yl]amino]methanol.
| Compound Name | [[(E)-2,8,8-trimethyldec-5-en-2-yl]amino]methanol |
|---|---|
| PubChem CID | 142399777 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | [[(E)-2,8,8-trimethyldec-5-en-2-yl]amino]methanol |
| SMILES | CCC(C)(C)C/C=C/CCC(C)(C)NCO |
| InChI | InChI=1S/C14H29NO/c1-6-13(2,3)10-8-7-9-11-14(4,5)15-12-16/h7-8,15-16H,6,9-12H2,1-5H3/b8-7+ |
| InChIKey | OLGKSBRXUXXHRQ-BQYQJAHWSA-N |
| XLogP | 3.47 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|