C12H25NO — CID 142399327
[[(E,2S)-8,8-dimethylnon-3-en-2-yl]amino]methanol (PubChem CID 142399327) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is [[(E,2S)-8,8-dimethylnon-3-en-2-yl]amino]methanol.
| Compound Name | [[(E,2S)-8,8-dimethylnon-3-en-2-yl]amino]methanol |
|---|---|
| PubChem CID | 142399327 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | [[(E,2S)-8,8-dimethylnon-3-en-2-yl]amino]methanol |
| SMILES | C[C@@H](/C=C/CCCC(C)(C)C)NCO |
| InChI | InChI=1S/C12H25NO/c1-11(13-10-14)8-6-5-7-9-12(2,3)4/h6,8,11,13-14H,5,7,9-10H2,1-4H3/b8-6+/t11-/m0/s1 |
| InChIKey | NXPDTUYJGPVJRV-IOCXFXADSA-N |
| XLogP | 2.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|