About [[(E)-2,8-dimethyldec-3-en-2-yl]amino]methanol
[[(E)-2,8-dimethyldec-3-en-2-yl]amino]methanol (PubChem CID 142399366) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is [[(E)-2,8-dimethyldec-3-en-2-yl]amino]methanol.
Molecular Properties
| Compound Name | [[(E)-2,8-dimethyldec-3-en-2-yl]amino]methanol |
| PubChem CID | 142399366 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | [[(E)-2,8-dimethyldec-3-en-2-yl]amino]methanol |
| SMILES | CCC(C)CCC/C=C/C(C)(C)NCO |
| InChI | InChI=1S/C13H27NO/c1-5-12(2)9-7-6-8-10-13(3,4)14-11-15/h8,10,12,14-15H,5-7,9,11H2,1-4H3/b10-8+ |
| InChIKey | GYVQVIDLWMJUBT-CSKARUKUSA-N |
| XLogP | 3.08 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [[(E)-2,8-dimethyldec-3-en-2-yl]amino]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(E)-2,8-dimethyldec-3-en-2-yl]amino]methanol?
The IUPAC name of [[(E)-2,8-dimethyldec-3-en-2-yl]amino]methanol (CID 142399366) is [[(E)-2,8-dimethyldec-3-en-2-yl]amino]methanol.
What is the SMILES notation for [[(E)-2,8-dimethyldec-3-en-2-yl]amino]methanol?
The canonical SMILES for [[(E)-2,8-dimethyldec-3-en-2-yl]amino]methanol is CCC(C)CCC/C=C/C(C)(C)NCO.
What is the InChIKey of [[(E)-2,8-dimethyldec-3-en-2-yl]amino]methanol?
The InChIKey is GYVQVIDLWMJUBT-CSKARUKUSA-N. The full InChI is InChI=1S/C13H27NO/c1-5-12(2)9-7-6-8-10-13(3,4)14-11-15/h8,10,12,14-15H,5-7,9,11H2,1-4H3/b10-8+.
What are the key properties of [[(E)-2,8-dimethyldec-3-en-2-yl]amino]methanol?
[[(E)-2,8-dimethyldec-3-en-2-yl]amino]methanol has a molecular weight of 213.36 g/mol, XLogP of 3.08, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [[(E)-2,8-dimethyldec-3-en-2-yl]amino]methanol is sourced from PubChem (CID 142399366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).