C11H19NO — CID 148871034
[(4-butylcyclohexa-1,5-dien-1-yl)amino]methanol (PubChem CID 148871034) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is [(4-butylcyclohexa-1,5-dien-1-yl)amino]methanol.
| Compound Name | [(4-butylcyclohexa-1,5-dien-1-yl)amino]methanol |
|---|---|
| PubChem CID | 148871034 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | [(4-butylcyclohexa-1,5-dien-1-yl)amino]methanol |
| SMILES | CCCCC1C=CC(NCO)=CC1 |
| InChI | InChI=1S/C11H19NO/c1-2-3-4-10-5-7-11(8-6-10)12-9-13/h5,7-8,10,12-13H,2-4,6,9H2,1H3 |
| InChIKey | PBELCWVMHUSSFZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|