C10H16FNO — CID 144509395
[[(Z,2E)-2-[(E)-3-fluoroprop-2-enylidene]hex-3-enyl]amino]methanol (PubChem CID 144509395) has the molecular formula C10H16FNO and a molecular weight of 185.24 g/mol. Its IUPAC name is [[(Z,2E)-2-[(E)-3-fluoroprop-2-enylidene]hex-3-enyl]amino]methanol.
| Compound Name | [[(Z,2E)-2-[(E)-3-fluoroprop-2-enylidene]hex-3-enyl]amino]methanol |
|---|---|
| PubChem CID | 144509395 |
| Molecular Formula | C10H16FNO |
| Molecular Weight | 185.24 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | [[(Z,2E)-2-[(E)-3-fluoroprop-2-enylidene]hex-3-enyl]amino]methanol |
| SMILES | CC/C=C\C(=C/C=C/F)CNCO |
| InChI | InChI=1S/C10H16FNO/c1-2-3-5-10(6-4-7-11)8-12-9-13/h3-7,12-13H,2,8-9H2,1H3/b5-3-,7-4+,10-6+ |
| InChIKey | FQZLINHDVQHDGO-YPXAAESQSA-N |
| XLogP | 1.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|