C15H31NO — CID 142918885
ethane;ethanol;(2E,4E,5Z)-4-ethylidene-N,2-dimethylhepta-2,5-dien-1-amine (PubChem CID 142918885) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is ethane;ethanol;(2E,4E,5Z)-4-ethylidene-N,2-dimethylhepta-2,5-dien-1-amine.
| Compound Name | ethane;ethanol;(2E,4E,5Z)-4-ethylidene-N,2-dimethylhepta-2,5-dien-1-amine |
|---|---|
| PubChem CID | 142918885 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | ethane;ethanol;(2E,4E,5Z)-4-ethylidene-N,2-dimethylhepta-2,5-dien-1-amine |
| SMILES | C/C=C\C(=C/C)\C=C(/C)CNC.CC.CCO |
| InChI | InChI=1S/C11H19N.C2H6O.C2H6/c1-5-7-11(6-2)8-10(3)9-12-4;1-2-3;1-2/h5-8,12H,9H2,1-4H3;3H,2H2,1H3;1-2H3/b7-5-,10-8+,11-6+;; |
| InChIKey | CBCKLVJFZJPYNO-JDOWHBQHSA-N |
| XLogP | 3.70 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|