C10H17NO — CID 88881134
2-[[(1Z,3Z,5Z)-2-methylhepta-1,3,5-trienyl]amino]ethanol (PubChem CID 88881134) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-[[(1Z,3Z,5Z)-2-methylhepta-1,3,5-trienyl]amino]ethanol.
| Compound Name | 2-[[(1Z,3Z,5Z)-2-methylhepta-1,3,5-trienyl]amino]ethanol |
|---|---|
| PubChem CID | 88881134 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2-[[(1Z,3Z,5Z)-2-methylhepta-1,3,5-trienyl]amino]ethanol |
| SMILES | C/C=C\C=C/C(C)=C\NCCO |
| InChI | InChI=1S/C10H17NO/c1-3-4-5-6-10(2)9-11-7-8-12/h3-6,9,11-12H,7-8H2,1-2H3/b4-3-,6-5-,10-9- |
| InChIKey | QGDBLDAQACDLIL-BNGSOVGLSA-N |
| XLogP | 1.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|