C11H23NO — CID 143654275
ethanol;(E,2Z)-2-ethylidene-N-methylhex-3-en-1-amine (PubChem CID 143654275) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is ethanol;(E,2Z)-2-ethylidene-N-methylhex-3-en-1-amine.
| Compound Name | ethanol;(E,2Z)-2-ethylidene-N-methylhex-3-en-1-amine |
|---|---|
| PubChem CID | 143654275 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | ethanol;(E,2Z)-2-ethylidene-N-methylhex-3-en-1-amine |
| SMILES | C/C=C(/C=C/CC)CNC.CCO |
| InChI | InChI=1S/C9H17N.C2H6O/c1-4-6-7-9(5-2)8-10-3;1-2-3/h5-7,10H,4,8H2,1-3H3;3H,2H2,1H3/b7-6+,9-5-; |
| InChIKey | VDILHUKOSGWKLR-JGHQXEFNSA-N |
| XLogP | 2.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|