C11H21NO — CID 143457518
ethanol;(2E)-N-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine (PubChem CID 143457518) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is ethanol;(2E)-N-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine.
| Compound Name | ethanol;(2E)-N-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 143457518 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | ethanol;(2E)-N-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine |
| SMILES | C=C/C=C(\C=C/C)CNC.CCO |
| InChI | InChI=1S/C9H15N.C2H6O/c1-4-6-9(7-5-2)8-10-3;1-2-3/h4-7,10H,1,8H2,2-3H3;3H,2H2,1H3/b7-5-,9-6+; |
| InChIKey | XJQFMMJYWDYNHI-UKRQJTKBSA-N |
| XLogP | 1.89 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|