C11H20FN — CID 142239852
ethane;(2E,3E)-2-ethylidene-4-fluoro-N-methylhexa-3,5-dien-1-amine (PubChem CID 142239852) has the molecular formula C11H20FN and a molecular weight of 185.29 g/mol. Its IUPAC name is ethane;(2E,3E)-2-ethylidene-4-fluoro-N-methylhexa-3,5-dien-1-amine.
| Compound Name | ethane;(2E,3E)-2-ethylidene-4-fluoro-N-methylhexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 142239852 |
| Molecular Formula | C11H20FN |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.16 |
| IUPAC Name | ethane;(2E,3E)-2-ethylidene-4-fluoro-N-methylhexa-3,5-dien-1-amine |
| SMILES | C=C/C(F)=C\C(=C/C)CNC.CC |
| InChI | InChI=1S/C9H14FN.C2H6/c1-4-8(7-11-3)6-9(10)5-2;1-2/h4-6,11H,2,7H2,1,3H3;1-2H3/b8-4+,9-6+; |
| InChIKey | VMERHAVWSLXNRQ-HQSPKJHHSA-N |
| XLogP | 3.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|