C11H19N — CID 123757982
3-ethylidene-N,6-dimethylhepta-4,6-dien-2-amine (PubChem CID 123757982) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 3-ethylidene-N,6-dimethylhepta-4,6-dien-2-amine.
| Compound Name | 3-ethylidene-N,6-dimethylhepta-4,6-dien-2-amine |
|---|---|
| PubChem CID | 123757982 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 3-ethylidene-N,6-dimethylhepta-4,6-dien-2-amine |
| SMILES | C=C(C)C=CC(=CC)C(C)NC |
| InChI | InChI=1S/C11H19N/c1-6-11(10(4)12-5)8-7-9(2)3/h6-8,10,12H,2H2,1,3-5H3 |
| InChIKey | RCBRRMZCTPXXBN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|