C18H31NO — CID 142528972
(2Z,4Z,6E)-3-[(cyclohexylamino)methyl]undeca-2,4,6-trien-2-ol (PubChem CID 142528972) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is (2Z,4Z,6E)-3-[(cyclohexylamino)methyl]undeca-2,4,6-trien-2-ol.
| Compound Name | (2Z,4Z,6E)-3-[(cyclohexylamino)methyl]undeca-2,4,6-trien-2-ol |
|---|---|
| PubChem CID | 142528972 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | (2Z,4Z,6E)-3-[(cyclohexylamino)methyl]undeca-2,4,6-trien-2-ol |
| SMILES | CCCC/C=C/C=C\C(CNC1CCCCC1)=C(/C)O |
| InChI | InChI=1S/C18H31NO/c1-3-4-5-6-7-9-12-17(16(2)20)15-19-18-13-10-8-11-14-18/h6-7,9,12,18-20H,3-5,8,10-11,13-15H2,1-2H3/b7-6+,12-9-,17-16- |
| InChIKey | FZABMVWDTBOPKD-MQUKZLAFSA-N |
| XLogP | 5.04 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|