C12H21NO — CID 142933385
(3E)-3-[(E)-3-methoxybut-2-enylidene]-N-methylcyclohexan-1-amine (PubChem CID 142933385) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (3E)-3-[(E)-3-methoxybut-2-enylidene]-N-methylcyclohexan-1-amine.
| Compound Name | (3E)-3-[(E)-3-methoxybut-2-enylidene]-N-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 142933385 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (3E)-3-[(E)-3-methoxybut-2-enylidene]-N-methylcyclohexan-1-amine |
| SMILES | CNC1CCC/C(=C\C=C(/C)OC)C1 |
| InChI | InChI=1S/C12H21NO/c1-10(14-3)7-8-11-5-4-6-12(9-11)13-2/h7-8,12-13H,4-6,9H2,1-3H3/b10-7+,11-8+ |
| InChIKey | PRJRRKSAUATMGO-AMMQDNIMSA-N |
| XLogP | 2.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|