C17H31NO — CID 123331927
3-ethyl-6-methoxy-N-(5-methylhex-5-enyl)hepta-3,5-dien-1-amine (PubChem CID 123331927) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is 3-ethyl-6-methoxy-N-(5-methylhex-5-enyl)hepta-3,5-dien-1-amine.
| Compound Name | 3-ethyl-6-methoxy-N-(5-methylhex-5-enyl)hepta-3,5-dien-1-amine |
|---|---|
| PubChem CID | 123331927 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | 3-ethyl-6-methoxy-N-(5-methylhex-5-enyl)hepta-3,5-dien-1-amine |
| SMILES | C=C(C)CCCCNCCC(=CC=C(C)OC)CC |
| InChI | InChI=1S/C17H31NO/c1-6-17(11-10-16(4)19-5)12-14-18-13-8-7-9-15(2)3/h10-11,18H,2,6-9,12-14H2,1,3-5H3 |
| InChIKey | ZROSKMWGNXVOJT-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|