C13H23NO — CID 142254546
4-[(2Z,4E)-5-methoxyhepta-2,4-dien-4-yl]piperidine (PubChem CID 142254546) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 4-[(2Z,4E)-5-methoxyhepta-2,4-dien-4-yl]piperidine.
| Compound Name | 4-[(2Z,4E)-5-methoxyhepta-2,4-dien-4-yl]piperidine |
|---|---|
| PubChem CID | 142254546 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 4-[(2Z,4E)-5-methoxyhepta-2,4-dien-4-yl]piperidine |
| SMILES | C/C=C\C(=C(/CC)OC)C1CCNCC1 |
| InChI | InChI=1S/C13H23NO/c1-4-6-12(13(5-2)15-3)11-7-9-14-10-8-11/h4,6,11,14H,5,7-10H2,1-3H3/b6-4-,13-12- |
| InChIKey | XHUXTTMCQXWXDC-SCEXNVPMSA-N |
| XLogP | 2.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|