C11H18N2O — CID 118610355
6-methoxy-5-piperidin-4-yl-1,2-dihydropyridine (PubChem CID 118610355) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 6-methoxy-5-piperidin-4-yl-1,2-dihydropyridine.
| Compound Name | 6-methoxy-5-piperidin-4-yl-1,2-dihydropyridine |
|---|---|
| PubChem CID | 118610355 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 6-methoxy-5-piperidin-4-yl-1,2-dihydropyridine |
| SMILES | COC1=C(C2CCNCC2)C=CCN1 |
| InChI | InChI=1S/C11H18N2O/c1-14-11-10(3-2-6-13-11)9-4-7-12-8-5-9/h2-3,9,12-13H,4-8H2,1H3 |
| InChIKey | JOGHQJXNFBRIGI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |