About 5-piperidin-4-yl-1,2-dihydropyridin-6-ol
5-piperidin-4-yl-1,2-dihydropyridin-6-ol (PubChem CID 118295066) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 5-piperidin-4-yl-1,2-dihydropyridin-6-ol.
Molecular Properties
| Compound Name | 5-piperidin-4-yl-1,2-dihydropyridin-6-ol |
| PubChem CID | 118295066 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 5-piperidin-4-yl-1,2-dihydropyridin-6-ol |
| SMILES | OC1=C(C2CCNCC2)C=CCN1 |
| InChI | InChI=1S/C10H16N2O/c13-10-9(2-1-5-12-10)8-3-6-11-7-4-8/h1-2,8,11-13H,3-7H2 |
| InChIKey | UOCJKSWHIRQIFO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-piperidin-4-yl-1,2-dihydropyridin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-piperidin-4-yl-1,2-dihydropyridin-6-ol?
The IUPAC name of 5-piperidin-4-yl-1,2-dihydropyridin-6-ol (CID 118295066) is 5-piperidin-4-yl-1,2-dihydropyridin-6-ol.
What is the SMILES notation for 5-piperidin-4-yl-1,2-dihydropyridin-6-ol?
The canonical SMILES for 5-piperidin-4-yl-1,2-dihydropyridin-6-ol is OC1=C(C2CCNCC2)C=CCN1.
What is the InChIKey of 5-piperidin-4-yl-1,2-dihydropyridin-6-ol?
The InChIKey is UOCJKSWHIRQIFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c13-10-9(2-1-5-12-10)8-3-6-11-7-4-8/h1-2,8,11-13H,3-7H2.
What are the key properties of 5-piperidin-4-yl-1,2-dihydropyridin-6-ol?
5-piperidin-4-yl-1,2-dihydropyridin-6-ol has a molecular weight of 180.25 g/mol, XLogP of 0.92, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-piperidin-4-yl-1,2-dihydropyridin-6-ol is sourced from PubChem (CID 118295066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).