C21H31N — CID 142075819
5-[(E)-but-2-enyl]-N-cyclohexyl-4-[(2E)-penta-2,4-dien-2-yl]cyclohexa-2,4-dien-1-amine (PubChem CID 142075819) has the molecular formula C21H31N and a molecular weight of 297.49 g/mol. Its IUPAC name is 5-[(E)-but-2-enyl]-N-cyclohexyl-4-[(2E)-penta-2,4-dien-2-yl]cyclohexa-2,4-dien-1-amine.
| Compound Name | 5-[(E)-but-2-enyl]-N-cyclohexyl-4-[(2E)-penta-2,4-dien-2-yl]cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142075819 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | 5-[(E)-but-2-enyl]-N-cyclohexyl-4-[(2E)-penta-2,4-dien-2-yl]cyclohexa-2,4-dien-1-amine |
| SMILES | C=C/C=C(\C)C1=C(C/C=C/C)CC(NC2CCCCC2)C=C1 |
| InChI | InChI=1S/C21H31N/c1-4-6-11-18-16-20(22-19-12-8-7-9-13-19)14-15-21(18)17(3)10-5-2/h4-6,10,14-15,19-20,22H,2,7-9,11-13,16H2,1,3H3/b6-4+,17-10+ |
| InChIKey | LHFSRTMHJACBDY-ZUCBPKHASA-N |
| XLogP | 5.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|