C14H25NO — CID 143560853
N-[(2E)-2-ethenylpenta-2,4-dienyl]cyclohexanamine;methanol (PubChem CID 143560853) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is N-[(2E)-2-ethenylpenta-2,4-dienyl]cyclohexanamine;methanol.
| Compound Name | N-[(2E)-2-ethenylpenta-2,4-dienyl]cyclohexanamine;methanol |
|---|---|
| PubChem CID | 143560853 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | N-[(2E)-2-ethenylpenta-2,4-dienyl]cyclohexanamine;methanol |
| SMILES | C=C/C=C(\C=C)CNC1CCCCC1.CO |
| InChI | InChI=1S/C13H21N.CH4O/c1-3-8-12(4-2)11-14-13-9-6-5-7-10-13;1-2/h3-4,8,13-14H,1-2,5-7,9-11H2;2H,1H3/b12-8+; |
| InChIKey | SICXSEQCEZZUTL-MXZHIVQLSA-N |
| XLogP | 2.82 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|