C12H21NO — CID 142924430
(2Z,4E,6E,8R)-8-(ethylamino)-7-methylnona-2,4,6-trien-4-ol (PubChem CID 142924430) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (2Z,4E,6E,8R)-8-(ethylamino)-7-methylnona-2,4,6-trien-4-ol.
| Compound Name | (2Z,4E,6E,8R)-8-(ethylamino)-7-methylnona-2,4,6-trien-4-ol |
|---|---|
| PubChem CID | 142924430 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (2Z,4E,6E,8R)-8-(ethylamino)-7-methylnona-2,4,6-trien-4-ol |
| SMILES | C/C=C\C(O)=C/C=C(\C)[C@@H](C)NCC |
| InChI | InChI=1S/C12H21NO/c1-5-7-12(14)9-8-10(3)11(4)13-6-2/h5,7-9,11,13-14H,6H2,1-4H3/b7-5-,10-8+,12-9+/t11-/m1/s1 |
| InChIKey | CNLQQEFTNVCLHE-PNHYPVKJSA-N |
| XLogP | 2.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|