C15H27NO — CID 143074594
(3E,5E)-7-(hexylamino)-6-methylocta-1,3,5-trien-4-ol (PubChem CID 143074594) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is (3E,5E)-7-(hexylamino)-6-methylocta-1,3,5-trien-4-ol.
| Compound Name | (3E,5E)-7-(hexylamino)-6-methylocta-1,3,5-trien-4-ol |
|---|---|
| PubChem CID | 143074594 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (3E,5E)-7-(hexylamino)-6-methylocta-1,3,5-trien-4-ol |
| SMILES | C=C/C=C(O)\C=C(/C)C(C)NCCCCCC |
| InChI | InChI=1S/C15H27NO/c1-5-7-8-9-11-16-14(4)13(3)12-15(17)10-6-2/h6,10,12,14,16-17H,2,5,7-9,11H2,1,3-4H3/b13-12+,15-10+ |
| InChIKey | FEWCHIJBJOFTRI-BKTKXEPCSA-N |
| XLogP | 4.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|