About (2E)-9-(methylamino)-7-methylidene-6-propylnona-2,5-dien-3-ol
(2E)-9-(methylamino)-7-methylidene-6-propylnona-2,5-dien-3-ol (PubChem CID 142933402) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is (2E)-9-(methylamino)-7-methylidene-6-propylnona-2,5-dien-3-ol.
Molecular Properties
| Compound Name | (2E)-9-(methylamino)-7-methylidene-6-propylnona-2,5-dien-3-ol |
| PubChem CID | 142933402 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (2E)-9-(methylamino)-7-methylidene-6-propylnona-2,5-dien-3-ol |
| SMILES | C=C(CCNC)C(=CC/C(O)=C\C)CCC |
| InChI | InChI=1S/C14H25NO/c1-5-7-13(8-9-14(16)6-2)12(3)10-11-15-4/h6,8,15-16H,3,5,7,9-11H2,1-2,4H3/b13-8?,14-6+ |
| InChIKey | XSXZSFIYFSOKJN-FYWBDWHJSA-N |
| XLogP | 3.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-9-(methylamino)-7-methylidene-6-propylnona-2,5-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-9-(methylamino)-7-methylidene-6-propylnona-2,5-dien-3-ol?
The IUPAC name of (2E)-9-(methylamino)-7-methylidene-6-propylnona-2,5-dien-3-ol (CID 142933402) is (2E)-9-(methylamino)-7-methylidene-6-propylnona-2,5-dien-3-ol.
What is the SMILES notation for (2E)-9-(methylamino)-7-methylidene-6-propylnona-2,5-dien-3-ol?
The canonical SMILES for (2E)-9-(methylamino)-7-methylidene-6-propylnona-2,5-dien-3-ol is C=C(CCNC)C(=CC/C(O)=C\C)CCC.
What is the InChIKey of (2E)-9-(methylamino)-7-methylidene-6-propylnona-2,5-dien-3-ol?
The InChIKey is XSXZSFIYFSOKJN-FYWBDWHJSA-N. The full InChI is InChI=1S/C14H25NO/c1-5-7-13(8-9-14(16)6-2)12(3)10-11-15-4/h6,8,15-16H,3,5,7,9-11H2,1-2,4H3/b13-8?,14-6+.
What are the key properties of (2E)-9-(methylamino)-7-methylidene-6-propylnona-2,5-dien-3-ol?
(2E)-9-(methylamino)-7-methylidene-6-propylnona-2,5-dien-3-ol has a molecular weight of 223.36 g/mol, XLogP of 3.73, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-9-(methylamino)-7-methylidene-6-propylnona-2,5-dien-3-ol is sourced from PubChem (CID 142933402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).