C15H27NO2 — CID 163517764
(3Z,5Z,8E)-6-[3-(methylamino)propyl]undeca-3,5,8-triene-3,4-diol (PubChem CID 163517764) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is (3Z,5Z,8E)-6-[3-(methylamino)propyl]undeca-3,5,8-triene-3,4-diol.
| Compound Name | (3Z,5Z,8E)-6-[3-(methylamino)propyl]undeca-3,5,8-triene-3,4-diol |
|---|---|
| PubChem CID | 163517764 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | (3Z,5Z,8E)-6-[3-(methylamino)propyl]undeca-3,5,8-triene-3,4-diol |
| SMILES | CC/C=C/C/C(=C\C(O)=C(\O)CC)CCCNC |
| InChI | InChI=1S/C15H27NO2/c1-4-6-7-9-13(10-8-11-16-3)12-15(18)14(17)5-2/h6-7,12,16-18H,4-5,8-11H2,1-3H3/b7-6+,13-12+,15-14- |
| InChIKey | DIFJTIHMCSAUIW-CAUNFULOSA-N |
| XLogP | 4.01 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|