About 1,8,10-triazabicyclo[5.3.0]deca-2,3,5,7,9-pentaene
1,8,10-triazabicyclo[5.3.0]deca-2,3,5,7,9-pentaene (PubChem CID 142933410) has the molecular formula C7H5N3
and a molecular weight of 131.14 g/mol. Its IUPAC name is 1,8,10-triazabicyclo[5.3.0]deca-2,3,5,7,9-pentaene.
Analyze 1,8,10-triazabicyclo[5.3.0]deca-2,3,5,7,9-pentaene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8,10-triazabicyclo[5.3.0]deca-2,3,5,7,9-pentaene?
The IUPAC name of 1,8,10-triazabicyclo[5.3.0]deca-2,3,5,7,9-pentaene (CID 142933410) is 1,8,10-triazabicyclo[5.3.0]deca-2,3,5,7,9-pentaene.
What is the SMILES notation for 1,8,10-triazabicyclo[5.3.0]deca-2,3,5,7,9-pentaene?
The canonical SMILES for 1,8,10-triazabicyclo[5.3.0]deca-2,3,5,7,9-pentaene is C1=CC=Cc2ncnn2C=1.
What is the InChIKey of 1,8,10-triazabicyclo[5.3.0]deca-2,3,5,7,9-pentaene?
The InChIKey is WOPBQNOHBJAISU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3/c1-2-4-7-8-6-9-10(7)5-3-1/h1-2,4-6H.
What are the key properties of 1,8,10-triazabicyclo[5.3.0]deca-2,3,5,7,9-pentaene?
1,8,10-triazabicyclo[5.3.0]deca-2,3,5,7,9-pentaene has a molecular weight of 131.14 g/mol, XLogP of 0.93, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8,10-triazabicyclo[5.3.0]deca-2,3,5,7,9-pentaene is sourced from PubChem (CID 142933410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).