About 1,8-diazabicyclo[5.4.0]undeca-2,4,5,7,9-pentaen-11-one
1,8-diazabicyclo[5.4.0]undeca-2,4,5,7,9-pentaen-11-one (PubChem CID 142933416) has the molecular formula C9H6N2O
and a molecular weight of 158.16 g/mol. Its IUPAC name is 1,8-diazabicyclo[5.4.0]undeca-2,4,5,7,9-pentaen-11-one.
Analyze 1,8-diazabicyclo[5.4.0]undeca-2,4,5,7,9-pentaen-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-diazabicyclo[5.4.0]undeca-2,4,5,7,9-pentaen-11-one?
The IUPAC name of 1,8-diazabicyclo[5.4.0]undeca-2,4,5,7,9-pentaen-11-one (CID 142933416) is 1,8-diazabicyclo[5.4.0]undeca-2,4,5,7,9-pentaen-11-one.
What is the SMILES notation for 1,8-diazabicyclo[5.4.0]undeca-2,4,5,7,9-pentaen-11-one?
The canonical SMILES for 1,8-diazabicyclo[5.4.0]undeca-2,4,5,7,9-pentaen-11-one is O=c1ccnc2n1C=CC=C=C2.
What is the InChIKey of 1,8-diazabicyclo[5.4.0]undeca-2,4,5,7,9-pentaen-11-one?
The InChIKey is ICEMCDRGULTXBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O/c12-9-5-6-10-8-4-2-1-3-7-11(8)9/h1,3-7H.
What are the key properties of 1,8-diazabicyclo[5.4.0]undeca-2,4,5,7,9-pentaen-11-one?
1,8-diazabicyclo[5.4.0]undeca-2,4,5,7,9-pentaen-11-one has a molecular weight of 158.16 g/mol, XLogP of 0.90, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-diazabicyclo[5.4.0]undeca-2,4,5,7,9-pentaen-11-one is sourced from PubChem (CID 142933416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).