C9H8N2O — CID 139231818
5H-pyrido[1,2-a][1,3]diazepin-2-one (PubChem CID 139231818) has the molecular formula C9H8N2O and a molecular weight of 160.18 g/mol. Its IUPAC name is 5H-pyrido[1,2-a][1,3]diazepin-2-one.
| Compound Name | 5H-pyrido[1,2-a][1,3]diazepin-2-one |
|---|---|
| PubChem CID | 139231818 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 5H-pyrido[1,2-a][1,3]diazepin-2-one |
| SMILES | O=C1C=CCN2C=CC=CC2=N1 |
| InChI | InChI=1S/C9H8N2O/c12-9-5-3-7-11-6-2-1-4-8(11)10-9/h1-6H,7H2 |
| InChIKey | DIQPAKMUMBSERP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |