C10H10N2O — CID 139231819
7-methyl-5H-pyrido[1,2-a][1,3]diazepin-2-one (PubChem CID 139231819) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 7-methyl-5H-pyrido[1,2-a][1,3]diazepin-2-one.
| Compound Name | 7-methyl-5H-pyrido[1,2-a][1,3]diazepin-2-one |
|---|---|
| PubChem CID | 139231819 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 7-methyl-5H-pyrido[1,2-a][1,3]diazepin-2-one |
| SMILES | CC1=CC=CC2=NC(=O)C=CCN12 |
| InChI | InChI=1S/C10H10N2O/c1-8-4-2-5-9-11-10(13)6-3-7-12(8)9/h2-6H,7H2,1H3 |
| InChIKey | BECICENJHPAQGZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |