About 3-[(1Z)-buta-1,3-dienyl]-2-ethenylpyrimidin-4-one;ethane
3-[(1Z)-buta-1,3-dienyl]-2-ethenylpyrimidin-4-one;ethane (PubChem CID 142933438) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-2-ethenylpyrimidin-4-one;ethane.
Molecular Properties
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-2-ethenylpyrimidin-4-one;ethane |
| PubChem CID | 142933438 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-2-ethenylpyrimidin-4-one;ethane |
| SMILES | C=C/C=C\n1c(C=C)nccc1=O.CC |
| InChI | InChI=1S/C10H10N2O.C2H6/c1-3-5-8-12-9(4-2)11-7-6-10(12)13;1-2/h3-8H,1-2H2;1-2H3/b8-5-; |
| InChIKey | AVMMPGFOXAGPCT-HGKIGUAWSA-N |
| XLogP | 2.57 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1Z)-buta-1,3-dienyl]-2-ethenylpyrimidin-4-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1Z)-buta-1,3-dienyl]-2-ethenylpyrimidin-4-one;ethane?
The IUPAC name of 3-[(1Z)-buta-1,3-dienyl]-2-ethenylpyrimidin-4-one;ethane (CID 142933438) is 3-[(1Z)-buta-1,3-dienyl]-2-ethenylpyrimidin-4-one;ethane.
What is the SMILES notation for 3-[(1Z)-buta-1,3-dienyl]-2-ethenylpyrimidin-4-one;ethane?
The canonical SMILES for 3-[(1Z)-buta-1,3-dienyl]-2-ethenylpyrimidin-4-one;ethane is C=C/C=C\n1c(C=C)nccc1=O.CC.
What is the InChIKey of 3-[(1Z)-buta-1,3-dienyl]-2-ethenylpyrimidin-4-one;ethane?
The InChIKey is AVMMPGFOXAGPCT-HGKIGUAWSA-N. The full InChI is InChI=1S/C10H10N2O.C2H6/c1-3-5-8-12-9(4-2)11-7-6-10(12)13;1-2/h3-8H,1-2H2;1-2H3/b8-5-;.
What are the key properties of 3-[(1Z)-buta-1,3-dienyl]-2-ethenylpyrimidin-4-one;ethane?
3-[(1Z)-buta-1,3-dienyl]-2-ethenylpyrimidin-4-one;ethane has a molecular weight of 204.27 g/mol, XLogP of 2.57, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1Z)-buta-1,3-dienyl]-2-ethenylpyrimidin-4-one;ethane is sourced from PubChem (CID 142933438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).