C20H20N2O2 — CID 142933508
(3Z,5E)-5-[2-[(E)-2-(4-methoxyphenyl)ethenyl]-1H-imidazol-5-yl]octa-3,5,7-trienal (PubChem CID 142933508) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is (3Z,5E)-5-[2-[(E)-2-(4-methoxyphenyl)ethenyl]-1H-imidazol-5-yl]octa-3,5,7-trienal.
| Compound Name | (3Z,5E)-5-[2-[(E)-2-(4-methoxyphenyl)ethenyl]-1H-imidazol-5-yl]octa-3,5,7-trienal |
|---|---|
| PubChem CID | 142933508 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (3Z,5E)-5-[2-[(E)-2-(4-methoxyphenyl)ethenyl]-1H-imidazol-5-yl]octa-3,5,7-trienal |
| SMILES | C=C/C=C(\C=C/CC=O)c1cnc(/C=C/c2ccc(OC)cc2)[nH]1 |
| InChI | InChI=1S/C20H20N2O2/c1-3-6-17(7-4-5-14-23)19-15-21-20(22-19)13-10-16-8-11-18(24-2)12-9-16/h3-4,6-15H,1,5H2,2H3,(H,21,22)/b7-4-,13-10+,17-6+ |
| InChIKey | OTERARZOSGEXDB-NAEMFIKLSA-N |
| XLogP | 4.30 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|