C17H27N5 — CID 142936605
(Z)-N'-[1-[[4-(2,2-dimethylpropylamino)phenyl]diazenyl]ethenyl]-N,N'-dimethylethene-1,2-diamine (PubChem CID 142936605) has the molecular formula C17H27N5 and a molecular weight of 301.44 g/mol. Its IUPAC name is (Z)-N'-[1-[[4-(2,2-dimethylpropylamino)phenyl]diazenyl]ethenyl]-N,N'-dimethylethene-1,2-diamine.
| Compound Name | (Z)-N'-[1-[[4-(2,2-dimethylpropylamino)phenyl]diazenyl]ethenyl]-N,N'-dimethylethene-1,2-diamine |
|---|---|
| PubChem CID | 142936605 |
| Molecular Formula | C17H27N5 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | (Z)-N'-[1-[[4-(2,2-dimethylpropylamino)phenyl]diazenyl]ethenyl]-N,N'-dimethylethene-1,2-diamine |
| SMILES | C=C(/N=N/c1ccc(NCC(C)(C)C)cc1)N(C)/C=C\NC |
| InChI | InChI=1S/C17H27N5/c1-14(22(6)12-11-18-5)20-21-16-9-7-15(8-10-16)19-13-17(2,3)4/h7-12,18-19H,1,13H2,2-6H3/b12-11-,21-20+ |
| InChIKey | ZSYBXYYIVHWULW-BHCBCLADSA-N |
| XLogP | 4.32 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|