C22H40N2 — CID 7688
1-N,4-N-di(octan-2-yl)benzene-1,4-diamine (PubChem CID 7688) has the molecular formula C22H40N2 and a molecular weight of 332.58 g/mol. Its IUPAC name is 1-N,4-N-di(octan-2-yl)benzene-1,4-diamine.
| Compound Name | 1-N,4-N-di(octan-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 7688 |
| Molecular Formula | C22H40N2 |
| Molecular Weight | 332.58 g/mol |
| Exact Mass | 332.32 |
| IUPAC Name | 1-N,4-N-di(octan-2-yl)benzene-1,4-diamine |
| SMILES | CCCCCCC(C)Nc1ccc(NC(C)CCCCCC)cc1 |
| InChI | InChI=1S/C22H40N2/c1-5-7-9-11-13-19(3)23-21-15-17-22(18-16-21)24-20(4)14-12-10-8-6-2/h15-20,23-24H,5-14H2,1-4H3 |
| InChIKey | APTGHASZJUAUCP-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.58 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|