C26H43N5O2 — CID 142936690
3-butyl-2-[2-[formyl(methyl)amino]ethylamino]-N,N-bis(3-methylbutyl)benzimidazole-5-carboxamide (PubChem CID 142936690) has the molecular formula C26H43N5O2 and a molecular weight of 457.66 g/mol. Its IUPAC name is 3-butyl-2-[2-[formyl(methyl)amino]ethylamino]-N,N-bis(3-methylbutyl)benzimidazole-5-carboxamide.
| Compound Name | 3-butyl-2-[2-[formyl(methyl)amino]ethylamino]-N,N-bis(3-methylbutyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 142936690 |
| Molecular Formula | C26H43N5O2 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.34 |
| IUPAC Name | 3-butyl-2-[2-[formyl(methyl)amino]ethylamino]-N,N-bis(3-methylbutyl)benzimidazole-5-carboxamide |
| SMILES | CCCCn1c(NCCN(C)C=O)nc2ccc(C(=O)N(CCC(C)C)CCC(C)C)cc21 |
| InChI | InChI=1S/C26H43N5O2/c1-7-8-14-31-24-18-22(25(33)30(15-11-20(2)3)16-12-21(4)5)9-10-23(24)28-26(31)27-13-17-29(6)19-32/h9-10,18-21H,7-8,11-17H2,1-6H3,(H,27,28) |
| InChIKey | CELTZQWZTNAOEW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|