C9H17NS — CID 142939688
3-but-1-enylsulfanyl-N-methylbut-3-en-1-amine (PubChem CID 142939688) has the molecular formula C9H17NS and a molecular weight of 171.31 g/mol. Its IUPAC name is 3-but-1-enylsulfanyl-N-methylbut-3-en-1-amine.
| Compound Name | 3-but-1-enylsulfanyl-N-methylbut-3-en-1-amine |
|---|---|
| PubChem CID | 142939688 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 3-but-1-enylsulfanyl-N-methylbut-3-en-1-amine |
| SMILES | C=C(CCNC)SC=CCC |
| InChI | InChI=1S/C9H17NS/c1-4-5-8-11-9(2)6-7-10-3/h5,8,10H,2,4,6-7H2,1,3H3 |
| InChIKey | QJMXIFKYPCDVPJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |