C13H6ClF3IN3S — CID 142939702
4-(4-chlorophenyl)-2-[4-iodo-5-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole (PubChem CID 142939702) has the molecular formula C13H6ClF3IN3S and a molecular weight of 455.63 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-[4-iodo-5-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole.
| Compound Name | 4-(4-chlorophenyl)-2-[4-iodo-5-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 142939702 |
| Molecular Formula | C13H6ClF3IN3S |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 454.90 |
| IUPAC Name | 4-(4-chlorophenyl)-2-[4-iodo-5-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole |
| SMILES | FC(F)(F)c1c(I)cnn1-c1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C13H6ClF3IN3S/c14-8-3-1-7(2-4-8)10-6-22-12(20-10)21-11(13(15,16)17)9(18)5-19-21/h1-6H |
| InChIKey | NCMUVKQDGXSDMD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|